C21H33N7O2 — CID 117084130
9-cyclohexyl-2-morpholin-4-yl-N-(2-morpholin-4-ylethyl)purin-6-amine (PubChem CID 117084130) has the molecular formula C21H33N7O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 9-cyclohexyl-2-morpholin-4-yl-N-(2-morpholin-4-ylethyl)purin-6-amine.
| Compound Name | 9-cyclohexyl-2-morpholin-4-yl-N-(2-morpholin-4-ylethyl)purin-6-amine |
|---|---|
| PubChem CID | 117084130 |
| Molecular Formula | C21H33N7O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | 9-cyclohexyl-2-morpholin-4-yl-N-(2-morpholin-4-ylethyl)purin-6-amine |
| SMILES | c1nc2c(NCCN3CCOCC3)nc(N3CCOCC3)nc2n1C1CCCCC1 |
| InChI | InChI=1S/C21H33N7O2/c1-2-4-17(5-3-1)28-16-23-18-19(22-6-7-26-8-12-29-13-9-26)24-21(25-20(18)28)27-10-14-30-15-11-27/h16-17H,1-15H2,(H,22,24,25) |
| InChIKey | FFNHSBHDIGLBAD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |