C25H28N6O2 — CID 90333026
9-cyclopentyl-N-[[4-(furan-3-yl)phenyl]methyl]-2-morpholin-4-ylpurin-6-amine (PubChem CID 90333026) has the molecular formula C25H28N6O2 and a molecular weight of 444.54 g/mol. Its IUPAC name is 9-cyclopentyl-N-[[4-(furan-3-yl)phenyl]methyl]-2-morpholin-4-ylpurin-6-amine.
| Compound Name | 9-cyclopentyl-N-[[4-(furan-3-yl)phenyl]methyl]-2-morpholin-4-ylpurin-6-amine |
|---|---|
| PubChem CID | 90333026 |
| Molecular Formula | C25H28N6O2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 9-cyclopentyl-N-[[4-(furan-3-yl)phenyl]methyl]-2-morpholin-4-ylpurin-6-amine |
| SMILES | c1cc(-c2ccc(CNc3nc(N4CCOCC4)nc4c3ncn4C3CCCC3)cc2)co1 |
| InChI | InChI=1S/C25H28N6O2/c1-2-4-21(3-1)31-17-27-22-23(28-25(29-24(22)31)30-10-13-32-14-11-30)26-15-18-5-7-19(8-6-18)20-9-12-33-16-20/h5-9,12,16-17,21H,1-4,10-11,13-15H2,(H,26,28,29) |
| InChIKey | FXAOHQGDOGQATR-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 81.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |