C24H29N7O — CID 154441598
2-N-(3-aminopropyl)-9-cyclopentyl-6-N-[[4-(furan-3-yl)phenyl]methyl]purine-2,6-diamine (PubChem CID 154441598) has the molecular formula C24H29N7O and a molecular weight of 431.54 g/mol. Its IUPAC name is 2-N-(3-aminopropyl)-9-cyclopentyl-6-N-[[4-(furan-3-yl)phenyl]methyl]purine-2,6-diamine.
| Compound Name | 2-N-(3-aminopropyl)-9-cyclopentyl-6-N-[[4-(furan-3-yl)phenyl]methyl]purine-2,6-diamine |
|---|---|
| PubChem CID | 154441598 |
| Molecular Formula | C24H29N7O |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 2-N-(3-aminopropyl)-9-cyclopentyl-6-N-[[4-(furan-3-yl)phenyl]methyl]purine-2,6-diamine |
| SMILES | NCCCNc1nc(NCc2ccc(-c3ccoc3)cc2)c2ncn(C3CCCC3)c2n1 |
| InChI | InChI=1S/C24H29N7O/c25-11-3-12-26-24-29-22(21-23(30-24)31(16-28-21)20-4-1-2-5-20)27-14-17-6-8-18(9-7-17)19-10-13-32-15-19/h6-10,13,15-16,20H,1-5,11-12,14,25H2,(H2,26,27,29,30) |
| InChIKey | PXFFVZIXMODHNS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 106.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|