C21H22N6O — CID 141410278
9-cyclopentyl-6-N-[[4-(furan-3-yl)phenyl]methyl]purine-2,6-diamine (PubChem CID 141410278) has the molecular formula C21H22N6O and a molecular weight of 374.45 g/mol. Its IUPAC name is 9-cyclopentyl-6-N-[[4-(furan-3-yl)phenyl]methyl]purine-2,6-diamine.
| Compound Name | 9-cyclopentyl-6-N-[[4-(furan-3-yl)phenyl]methyl]purine-2,6-diamine |
|---|---|
| PubChem CID | 141410278 |
| Molecular Formula | C21H22N6O |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 9-cyclopentyl-6-N-[[4-(furan-3-yl)phenyl]methyl]purine-2,6-diamine |
| SMILES | Nc1nc(NCc2ccc(-c3ccoc3)cc2)c2ncn(C3CCCC3)c2n1 |
| InChI | InChI=1S/C21H22N6O/c22-21-25-19(18-20(26-21)27(13-24-18)17-3-1-2-4-17)23-11-14-5-7-15(8-6-14)16-9-10-28-12-16/h5-10,12-13,17H,1-4,11H2,(H3,22,23,25,26) |
| InChIKey | OZFVQNVGSRHKLX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 94.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |