C27H30N6O2 — CID 118590011
4-[4-[[[2-(2-aminopropyl)-9-cyclopentylpurin-6-yl]amino]methyl]phenyl]benzoic acid (PubChem CID 118590011) has the molecular formula C27H30N6O2 and a molecular weight of 470.58 g/mol. Its IUPAC name is 4-[4-[[[2-(2-aminopropyl)-9-cyclopentylpurin-6-yl]amino]methyl]phenyl]benzoic acid.
| Compound Name | 4-[4-[[[2-(2-aminopropyl)-9-cyclopentylpurin-6-yl]amino]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 118590011 |
| Molecular Formula | C27H30N6O2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 4-[4-[[[2-(2-aminopropyl)-9-cyclopentylpurin-6-yl]amino]methyl]phenyl]benzoic acid |
| SMILES | CC(N)Cc1nc(NCc2ccc(-c3ccc(C(=O)O)cc3)cc2)c2ncn(C3CCCC3)c2n1 |
| InChI | InChI=1S/C27H30N6O2/c1-17(28)14-23-31-25(24-26(32-23)33(16-30-24)22-4-2-3-5-22)29-15-18-6-8-19(9-7-18)20-10-12-21(13-11-20)27(34)35/h6-13,16-17,22H,2-5,14-15,28H2,1H3,(H,34,35)(H,29,31,32) |
| InChIKey | MLHCUPCCPQIFNP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |