C27H31N7O — CID 118590066
2-[4-[[(9-cyclopentyl-2-piperazin-1-ylpurin-6-yl)amino]methyl]phenyl]phenol (PubChem CID 118590066) has the molecular formula C27H31N7O and a molecular weight of 469.59 g/mol. Its IUPAC name is 2-[4-[[(9-cyclopentyl-2-piperazin-1-ylpurin-6-yl)amino]methyl]phenyl]phenol.
| Compound Name | 2-[4-[[(9-cyclopentyl-2-piperazin-1-ylpurin-6-yl)amino]methyl]phenyl]phenol |
|---|---|
| PubChem CID | 118590066 |
| Molecular Formula | C27H31N7O |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | 2-[4-[[(9-cyclopentyl-2-piperazin-1-ylpurin-6-yl)amino]methyl]phenyl]phenol |
| SMILES | Oc1ccccc1-c1ccc(CNc2nc(N3CCNCC3)nc3c2ncn3C2CCCC2)cc1 |
| InChI | InChI=1S/C27H31N7O/c35-23-8-4-3-7-22(23)20-11-9-19(10-12-20)17-29-25-24-26(34(18-30-24)21-5-1-2-6-21)32-27(31-25)33-15-13-28-14-16-33/h3-4,7-12,18,21,28,35H,1-2,5-6,13-17H2,(H,29,31,32) |
| InChIKey | HGFBFACLGVWLTC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |