C31H40N8O2 — CID 90332861
2-[2-[4-[6-[[4-(2-aminophenyl)phenyl]methylamino]-9-cyclopentylpurin-2-yl]piperazin-1-yl]ethoxy]ethanol (PubChem CID 90332861) has the molecular formula C31H40N8O2 and a molecular weight of 556.72 g/mol. Its IUPAC name is 2-[2-[4-[6-[[4-(2-aminophenyl)phenyl]methylamino]-9-cyclopentylpurin-2-yl]piperazin-1-yl]ethoxy]ethanol.
| Compound Name | 2-[2-[4-[6-[[4-(2-aminophenyl)phenyl]methylamino]-9-cyclopentylpurin-2-yl]piperazin-1-yl]ethoxy]ethanol |
|---|---|
| PubChem CID | 90332861 |
| Molecular Formula | C31H40N8O2 |
| Molecular Weight | 556.72 g/mol |
| Exact Mass | 556.33 |
| IUPAC Name | 2-[2-[4-[6-[[4-(2-aminophenyl)phenyl]methylamino]-9-cyclopentylpurin-2-yl]piperazin-1-yl]ethoxy]ethanol |
| SMILES | Nc1ccccc1-c1ccc(CNc2nc(N3CCN(CCOCCO)CC3)nc3c2ncn3C2CCCC2)cc1 |
| InChI | InChI=1S/C31H40N8O2/c32-27-8-4-3-7-26(27)24-11-9-23(10-12-24)21-33-29-28-30(39(22-34-28)25-5-1-2-6-25)36-31(35-29)38-15-13-37(14-16-38)17-19-41-20-18-40/h3-4,7-12,22,25,40H,1-2,5-6,13-21,32H2,(H,33,35,36) |
| InChIKey | AVIBQEQMQYIZFR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.72 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|