C16H25N7O2 — CID 117094178
2-[[2-(4-morpholin-4-ylpiperidin-1-yl)-7H-purin-6-yl]amino]ethanol (PubChem CID 117094178) has the molecular formula C16H25N7O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-[[2-(4-morpholin-4-ylpiperidin-1-yl)-7H-purin-6-yl]amino]ethanol.
| Compound Name | 2-[[2-(4-morpholin-4-ylpiperidin-1-yl)-7H-purin-6-yl]amino]ethanol |
|---|---|
| PubChem CID | 117094178 |
| Molecular Formula | C16H25N7O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 2-[[2-(4-morpholin-4-ylpiperidin-1-yl)-7H-purin-6-yl]amino]ethanol |
| SMILES | OCCNc1nc(N2CCC(N3CCOCC3)CC2)nc2nc[nH]c12 |
| InChI | InChI=1S/C16H25N7O2/c24-8-3-17-14-13-15(19-11-18-13)21-16(20-14)23-4-1-12(2-5-23)22-6-9-25-10-7-22/h11-12,24H,1-10H2,(H2,17,18,19,20,21) |
| InChIKey | IXBBHDGYWAWVNC-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |