C20H26N8 — CID 154843471
2-[3-(4-methylpiperazin-1-yl)pyrrolidin-1-yl]-N-phenyl-7H-purin-6-amine (PubChem CID 154843471) has the molecular formula C20H26N8 and a molecular weight of 378.48 g/mol. Its IUPAC name is 2-[3-(4-methylpiperazin-1-yl)pyrrolidin-1-yl]-N-phenyl-7H-purin-6-amine.
| Compound Name | 2-[3-(4-methylpiperazin-1-yl)pyrrolidin-1-yl]-N-phenyl-7H-purin-6-amine |
|---|---|
| PubChem CID | 154843471 |
| Molecular Formula | C20H26N8 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 2-[3-(4-methylpiperazin-1-yl)pyrrolidin-1-yl]-N-phenyl-7H-purin-6-amine |
| SMILES | CN1CCN(C2CCN(c3nc(Nc4ccccc4)c4[nH]cnc4n3)C2)CC1 |
| InChI | InChI=1S/C20H26N8/c1-26-9-11-27(12-10-26)16-7-8-28(13-16)20-24-18-17(21-14-22-18)19(25-20)23-15-5-3-2-4-6-15/h2-6,14,16H,7-13H2,1H3,(H2,21,22,23,24,25) |
| InChIKey | HRGZBQWZQFUJRM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |