C24H31N9O2 — CID 158970374
[5-[(9-cyclopentyl-2-morpholin-4-ylpurin-6-yl)amino]-2-pyridinyl]-piperazin-1-ylmethanone (PubChem CID 158970374) has the molecular formula C24H31N9O2 and a molecular weight of 477.57 g/mol. Its IUPAC name is [5-[(9-cyclopentyl-2-morpholin-4-ylpurin-6-yl)amino]-2-pyridinyl]-piperazin-1-ylmethanone.
| Compound Name | [5-[(9-cyclopentyl-2-morpholin-4-ylpurin-6-yl)amino]-2-pyridinyl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 158970374 |
| Molecular Formula | C24H31N9O2 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | [5-[(9-cyclopentyl-2-morpholin-4-ylpurin-6-yl)amino]-2-pyridinyl]-piperazin-1-ylmethanone |
| SMILES | O=C(c1ccc(Nc2nc(N3CCOCC3)nc3c2ncn3C2CCCC2)cn1)N1CCNCC1 |
| InChI | InChI=1S/C24H31N9O2/c34-23(31-9-7-25-8-10-31)19-6-5-17(15-26-19)28-21-20-22(33(16-27-20)18-3-1-2-4-18)30-24(29-21)32-11-13-35-14-12-32/h5-6,15-16,18,25H,1-4,7-14H2,(H,28,29,30) |
| InChIKey | JNSTXBGHSOMGER-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |