C24H34N10 — CID 160921333
9-cyclopentyl-2-(4-methylpiperazin-1-yl)-N-(6-piperazin-1-yl-3-pyridinyl)purin-6-amine (PubChem CID 160921333) has the molecular formula C24H34N10 and a molecular weight of 462.61 g/mol. Its IUPAC name is 9-cyclopentyl-2-(4-methylpiperazin-1-yl)-N-(6-piperazin-1-yl-3-pyridinyl)purin-6-amine.
| Compound Name | 9-cyclopentyl-2-(4-methylpiperazin-1-yl)-N-(6-piperazin-1-yl-3-pyridinyl)purin-6-amine |
|---|---|
| PubChem CID | 160921333 |
| Molecular Formula | C24H34N10 |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | 9-cyclopentyl-2-(4-methylpiperazin-1-yl)-N-(6-piperazin-1-yl-3-pyridinyl)purin-6-amine |
| SMILES | CN1CCN(c2nc(Nc3ccc(N4CCNCC4)nc3)c3ncn(C4CCCC4)c3n2)CC1 |
| InChI | InChI=1S/C24H34N10/c1-31-12-14-33(15-13-31)24-29-22(21-23(30-24)34(17-27-21)19-4-2-3-5-19)28-18-6-7-20(26-16-18)32-10-8-25-9-11-32/h6-7,16-17,19,25H,2-5,8-15H2,1H3,(H,28,29,30) |
| InChIKey | SSBLZIRRCBAVLJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |