C23H29N9O2 — CID 157235463
2-[[9-cyclopentyl-6-[4-(piperazine-1-carbonyl)anilino]purin-2-yl]amino]acetamide (PubChem CID 157235463) has the molecular formula C23H29N9O2 and a molecular weight of 463.55 g/mol. Its IUPAC name is 2-[[9-cyclopentyl-6-[4-(piperazine-1-carbonyl)anilino]purin-2-yl]amino]acetamide.
| Compound Name | 2-[[9-cyclopentyl-6-[4-(piperazine-1-carbonyl)anilino]purin-2-yl]amino]acetamide |
|---|---|
| PubChem CID | 157235463 |
| Molecular Formula | C23H29N9O2 |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | 2-[[9-cyclopentyl-6-[4-(piperazine-1-carbonyl)anilino]purin-2-yl]amino]acetamide |
| SMILES | NC(=O)CNc1nc(Nc2ccc(C(=O)N3CCNCC3)cc2)c2ncn(C3CCCC3)c2n1 |
| InChI | InChI=1S/C23H29N9O2/c24-18(33)13-26-23-29-20(19-21(30-23)32(14-27-19)17-3-1-2-4-17)28-16-7-5-15(6-8-16)22(34)31-11-9-25-10-12-31/h5-8,14,17,25H,1-4,9-13H2,(H2,24,33)(H2,26,28,29,30) |
| InChIKey | AUOUNXAEZXVKIR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 143.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |