C31H31ClN8O2 — CID 162662377
N-(2-aminophenyl)-4-[[[6-(3-chloroanilino)-9-cyclopentylpurin-2-yl]amino]methoxymethyl]benzamide (PubChem CID 162662377) has the molecular formula C31H31ClN8O2 and a molecular weight of 583.10 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[[6-(3-chloroanilino)-9-cyclopentylpurin-2-yl]amino]methoxymethyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[[6-(3-chloroanilino)-9-cyclopentylpurin-2-yl]amino]methoxymethyl]benzamide |
|---|---|
| PubChem CID | 162662377 |
| Molecular Formula | C31H31ClN8O2 |
| Molecular Weight | 583.10 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | N-(2-aminophenyl)-4-[[[6-(3-chloroanilino)-9-cyclopentylpurin-2-yl]amino]methoxymethyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(COCNc2nc(Nc3cccc(Cl)c3)c3ncn(C4CCCC4)c3n2)cc1 |
| InChI | InChI=1S/C31H31ClN8O2/c32-22-6-5-7-23(16-22)36-28-27-29(40(18-34-27)24-8-1-2-9-24)39-31(38-28)35-19-42-17-20-12-14-21(15-13-20)30(41)37-26-11-4-3-10-25(26)33/h3-7,10-16,18,24H,1-2,8-9,17,19,33H2,(H,37,41)(H2,35,36,38,39) |
| InChIKey | GEZBIVIMESITCD-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 132.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.10 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|