C25H36N10O — CID 151352382
2-[3-[[9-cyclopentyl-6-[4-(morpholin-4-ylmethyl)anilino]purin-2-yl]amino]propyl]guanidine (PubChem CID 151352382) has the molecular formula C25H36N10O and a molecular weight of 492.63 g/mol. Its IUPAC name is 2-[3-[[9-cyclopentyl-6-[4-(morpholin-4-ylmethyl)anilino]purin-2-yl]amino]propyl]guanidine.
| Compound Name | 2-[3-[[9-cyclopentyl-6-[4-(morpholin-4-ylmethyl)anilino]purin-2-yl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 151352382 |
| Molecular Formula | C25H36N10O |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | 2-[3-[[9-cyclopentyl-6-[4-(morpholin-4-ylmethyl)anilino]purin-2-yl]amino]propyl]guanidine |
| SMILES | NC(N)=NCCCNc1nc(Nc2ccc(CN3CCOCC3)cc2)c2ncn(C3CCCC3)c2n1 |
| InChI | InChI=1S/C25H36N10O/c26-24(27)28-10-3-11-29-25-32-22(21-23(33-25)35(17-30-21)20-4-1-2-5-20)31-19-8-6-18(7-9-19)16-34-12-14-36-15-13-34/h6-9,17,20H,1-5,10-16H2,(H4,26,27,28)(H2,29,31,32,33) |
| InChIKey | OMTDVDZGKPJABO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 144.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|