C24H34N10O2 — CID 162511206
4-[[9-cyclopentyl-6-[(6-morpholin-4-yl-3-pyridinyl)amino]purin-2-yl]amino]butylurea (PubChem CID 162511206) has the molecular formula C24H34N10O2 and a molecular weight of 494.60 g/mol. Its IUPAC name is 4-[[9-cyclopentyl-6-[(6-morpholin-4-yl-3-pyridinyl)amino]purin-2-yl]amino]butylurea.
| Compound Name | 4-[[9-cyclopentyl-6-[(6-morpholin-4-yl-3-pyridinyl)amino]purin-2-yl]amino]butylurea |
|---|---|
| PubChem CID | 162511206 |
| Molecular Formula | C24H34N10O2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | 4-[[9-cyclopentyl-6-[(6-morpholin-4-yl-3-pyridinyl)amino]purin-2-yl]amino]butylurea |
| SMILES | NC(=O)NCCCCNc1nc(Nc2ccc(N3CCOCC3)nc2)c2ncn(C3CCCC3)c2n1 |
| InChI | InChI=1S/C24H34N10O2/c25-23(35)26-9-3-4-10-27-24-31-21(20-22(32-24)34(16-29-20)18-5-1-2-6-18)30-17-7-8-19(28-15-17)33-11-13-36-14-12-33/h7-8,15-16,18H,1-6,9-14H2,(H3,25,26,35)(H2,27,30,31,32) |
| InChIKey | QJWQCNCMKJOWTA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 148.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|