C27H40N10O — CID 150356248
2-[5-[[9-cyclopentyl-6-[4-(morpholin-4-ylmethyl)anilino]purin-2-yl]amino]pentyl]guanidine (PubChem CID 150356248) has the molecular formula C27H40N10O and a molecular weight of 520.69 g/mol. Its IUPAC name is 2-[5-[[9-cyclopentyl-6-[4-(morpholin-4-ylmethyl)anilino]purin-2-yl]amino]pentyl]guanidine.
| Compound Name | 2-[5-[[9-cyclopentyl-6-[4-(morpholin-4-ylmethyl)anilino]purin-2-yl]amino]pentyl]guanidine |
|---|---|
| PubChem CID | 150356248 |
| Molecular Formula | C27H40N10O |
| Molecular Weight | 520.69 g/mol |
| Exact Mass | 520.34 |
| IUPAC Name | 2-[5-[[9-cyclopentyl-6-[4-(morpholin-4-ylmethyl)anilino]purin-2-yl]amino]pentyl]guanidine |
| SMILES | NC(N)=NCCCCCNc1nc(Nc2ccc(CN3CCOCC3)cc2)c2ncn(C3CCCC3)c2n1 |
| InChI | InChI=1S/C27H40N10O/c28-26(29)30-12-4-1-5-13-31-27-34-24(23-25(35-27)37(19-32-23)22-6-2-3-7-22)33-21-10-8-20(9-11-21)18-36-14-16-38-17-15-36/h8-11,19,22H,1-7,12-18H2,(H4,28,29,30)(H2,31,33,34,35) |
| InChIKey | GUTUVAXJHFERIS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 144.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.69 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|