C24H33FN8 — CID 123387648
9-tert-butyl-2-(3-fluoropyrrolidin-1-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]purin-6-amine (PubChem CID 123387648) has the molecular formula C24H33FN8 and a molecular weight of 452.58 g/mol. Its IUPAC name is 9-tert-butyl-2-(3-fluoropyrrolidin-1-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]purin-6-amine.
| Compound Name | 9-tert-butyl-2-(3-fluoropyrrolidin-1-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]purin-6-amine |
|---|---|
| PubChem CID | 123387648 |
| Molecular Formula | C24H33FN8 |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | 9-tert-butyl-2-(3-fluoropyrrolidin-1-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]purin-6-amine |
| SMILES | CN1CCN(c2ccc(Nc3nc(N4CCC(F)C4)nc4c3ncn4C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C24H33FN8/c1-24(2,3)33-16-26-20-21(28-23(29-22(20)33)32-10-9-17(25)15-32)27-18-5-7-19(8-6-18)31-13-11-30(4)12-14-31/h5-8,16-17H,9-15H2,1-4H3,(H,27,28,29) |
| InChIKey | YVVGJZDCARSIQR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 65.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|