C24H33N9O2 — CID 118073709
[1-[6-[4-(4-methylpiperazin-1-yl)anilino]-9-propan-2-ylpurin-2-yl]pyrrolidin-3-yl]carbamic acid (PubChem CID 118073709) has the molecular formula C24H33N9O2 and a molecular weight of 479.59 g/mol. Its IUPAC name is [1-[6-[4-(4-methylpiperazin-1-yl)anilino]-9-propan-2-ylpurin-2-yl]pyrrolidin-3-yl]carbamic acid.
| Compound Name | [1-[6-[4-(4-methylpiperazin-1-yl)anilino]-9-propan-2-ylpurin-2-yl]pyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 118073709 |
| Molecular Formula | C24H33N9O2 |
| Molecular Weight | 479.59 g/mol |
| Exact Mass | 479.28 |
| IUPAC Name | [1-[6-[4-(4-methylpiperazin-1-yl)anilino]-9-propan-2-ylpurin-2-yl]pyrrolidin-3-yl]carbamic acid |
| SMILES | CC(C)n1cnc2c(Nc3ccc(N4CCN(C)CC4)cc3)nc(N3CCC(NC(=O)O)C3)nc21 |
| InChI | InChI=1S/C24H33N9O2/c1-16(2)33-15-25-20-21(26-17-4-6-19(7-5-17)31-12-10-30(3)11-13-31)28-23(29-22(20)33)32-9-8-18(14-32)27-24(34)35/h4-7,15-16,18,27H,8-14H2,1-3H3,(H,34,35)(H,26,28,29) |
| InChIKey | JZTDARMXCFQGAA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.59 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|