C32H43N9O — CID 145096849
N-[(3S)-1-[6-[[1-[(1R)-1-phenyl-2-propylpentyl]pyrazol-4-yl]amino]-9-propan-2-ylpurin-2-yl]pyrrolidin-3-yl]prop-2-enamide (PubChem CID 145096849) has the molecular formula C32H43N9O and a molecular weight of 569.76 g/mol. Its IUPAC name is N-[(3S)-1-[6-[[1-[(1R)-1-phenyl-2-propylpentyl]pyrazol-4-yl]amino]-9-propan-2-ylpurin-2-yl]pyrrolidin-3-yl]prop-2-enamide.
| Compound Name | N-[(3S)-1-[6-[[1-[(1R)-1-phenyl-2-propylpentyl]pyrazol-4-yl]amino]-9-propan-2-ylpurin-2-yl]pyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 145096849 |
| Molecular Formula | C32H43N9O |
| Molecular Weight | 569.76 g/mol |
| Exact Mass | 569.36 |
| IUPAC Name | N-[(3S)-1-[6-[[1-[(1R)-1-phenyl-2-propylpentyl]pyrazol-4-yl]amino]-9-propan-2-ylpurin-2-yl]pyrrolidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CCN(c2nc(Nc3cnn([C@@H](c4ccccc4)C(CCC)CCC)c3)c3ncn(C(C)C)c3n2)C1 |
| InChI | InChI=1S/C32H43N9O/c1-6-12-23(13-7-2)29(24-14-10-9-11-15-24)41-20-26(18-34-41)36-30-28-31(40(21-33-28)22(4)5)38-32(37-30)39-17-16-25(19-39)35-27(42)8-3/h8-11,14-15,18,20-23,25,29H,3,6-7,12-13,16-17,19H2,1-2,4-5H3,(H,35,42)(H,36,37,38)/t25-,29+/m0/s1 |
| InChIKey | APZONJNYWZLHJW-ABYGYWHVSA-N |
| XLogP | 6.03 |
| TPSA | 105.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.76 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|