C28H34N8O2 — CID 117079543
2-N,6-N-bis(4-morpholin-4-ylphenyl)-9-propan-2-ylpurine-2,6-diamine (PubChem CID 117079543) has the molecular formula C28H34N8O2 and a molecular weight of 514.63 g/mol. Its IUPAC name is 2-N,6-N-bis(4-morpholin-4-ylphenyl)-9-propan-2-ylpurine-2,6-diamine.
| Compound Name | 2-N,6-N-bis(4-morpholin-4-ylphenyl)-9-propan-2-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117079543 |
| Molecular Formula | C28H34N8O2 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | 2-N,6-N-bis(4-morpholin-4-ylphenyl)-9-propan-2-ylpurine-2,6-diamine |
| SMILES | CC(C)n1cnc2c(Nc3ccc(N4CCOCC4)cc3)nc(Nc3ccc(N4CCOCC4)cc3)nc21 |
| InChI | InChI=1S/C28H34N8O2/c1-20(2)36-19-29-25-26(30-21-3-7-23(8-4-21)34-11-15-37-16-12-34)32-28(33-27(25)36)31-22-5-9-24(10-6-22)35-13-17-38-18-14-35/h3-10,19-20H,11-18H2,1-2H3,(H2,30,31,32,33) |
| InChIKey | RFRJCZYARDICPX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|