C24H34N8O2 — CID 117082508
2-N-(2-morpholin-4-ylethyl)-6-N-(4-morpholin-4-ylphenyl)-9-propan-2-ylpurine-2,6-diamine (PubChem CID 117082508) has the molecular formula C24H34N8O2 and a molecular weight of 466.59 g/mol. Its IUPAC name is 2-N-(2-morpholin-4-ylethyl)-6-N-(4-morpholin-4-ylphenyl)-9-propan-2-ylpurine-2,6-diamine.
| Compound Name | 2-N-(2-morpholin-4-ylethyl)-6-N-(4-morpholin-4-ylphenyl)-9-propan-2-ylpurine-2,6-diamine |
|---|---|
| PubChem CID | 117082508 |
| Molecular Formula | C24H34N8O2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | 2-N-(2-morpholin-4-ylethyl)-6-N-(4-morpholin-4-ylphenyl)-9-propan-2-ylpurine-2,6-diamine |
| SMILES | CC(C)n1cnc2c(Nc3ccc(N4CCOCC4)cc3)nc(NCCN3CCOCC3)nc21 |
| InChI | InChI=1S/C24H34N8O2/c1-18(2)32-17-26-21-22(27-19-3-5-20(6-4-19)31-11-15-34-16-12-31)28-24(29-23(21)32)25-7-8-30-9-13-33-14-10-30/h3-6,17-18H,7-16H2,1-2H3,(H2,25,27,28,29) |
| InChIKey | ZOXXDCQKVZOJTJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|