C24H33N7O2 — CID 117081628
4-[[6-(4-morpholin-4-ylanilino)-9-propan-2-ylpurin-2-yl]amino]cyclohexan-1-ol (PubChem CID 117081628) has the molecular formula C24H33N7O2 and a molecular weight of 451.58 g/mol. Its IUPAC name is 4-[[6-(4-morpholin-4-ylanilino)-9-propan-2-ylpurin-2-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[6-(4-morpholin-4-ylanilino)-9-propan-2-ylpurin-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 117081628 |
| Molecular Formula | C24H33N7O2 |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | 4-[[6-(4-morpholin-4-ylanilino)-9-propan-2-ylpurin-2-yl]amino]cyclohexan-1-ol |
| SMILES | CC(C)n1cnc2c(Nc3ccc(N4CCOCC4)cc3)nc(NC3CCC(O)CC3)nc21 |
| InChI | InChI=1S/C24H33N7O2/c1-16(2)31-15-25-21-22(26-17-3-7-19(8-4-17)30-11-13-33-14-12-30)28-24(29-23(21)31)27-18-5-9-20(32)10-6-18/h3-4,7-8,15-16,18,20,32H,5-6,9-14H2,1-2H3,(H2,26,27,28,29) |
| InChIKey | DDRIFALSCFETMG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|