C29H36N8O3S — CID 23504684
4-[[9-ethyl-6-[4-(4-phenylpiperazin-1-yl)sulfonylanilino]purin-2-yl]amino]cyclohexan-1-ol (PubChem CID 23504684) has the molecular formula C29H36N8O3S and a molecular weight of 576.73 g/mol. Its IUPAC name is 4-[[9-ethyl-6-[4-(4-phenylpiperazin-1-yl)sulfonylanilino]purin-2-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[9-ethyl-6-[4-(4-phenylpiperazin-1-yl)sulfonylanilino]purin-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 23504684 |
| Molecular Formula | C29H36N8O3S |
| Molecular Weight | 576.73 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | 4-[[9-ethyl-6-[4-(4-phenylpiperazin-1-yl)sulfonylanilino]purin-2-yl]amino]cyclohexan-1-ol |
| SMILES | CCn1cnc2c(Nc3ccc(S(=O)(=O)N4CCN(c5ccccc5)CC4)cc3)nc(NC3CCC(O)CC3)nc21 |
| InChI | InChI=1S/C29H36N8O3S/c1-2-35-20-30-26-27(33-29(34-28(26)35)32-22-8-12-24(38)13-9-22)31-21-10-14-25(15-11-21)41(39,40)37-18-16-36(17-19-37)23-6-4-3-5-7-23/h3-7,10-11,14-15,20,22,24,38H,2,8-9,12-13,16-19H2,1H3,(H2,31,32,33,34) |
| InChIKey | PAKZIMFWBUQFCQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.73 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |