C19H26N7O2PS — CID 21059575
2-N-(4-aminocyclohexyl)-6-N-(4-dihydroxyphosphinothioylphenyl)-9-ethylpurine-2,6-diamine (PubChem CID 21059575) has the molecular formula C19H26N7O2PS and a molecular weight of 447.51 g/mol. Its IUPAC name is 2-N-(4-aminocyclohexyl)-6-N-(4-dihydroxyphosphinothioylphenyl)-9-ethylpurine-2,6-diamine.
| Compound Name | 2-N-(4-aminocyclohexyl)-6-N-(4-dihydroxyphosphinothioylphenyl)-9-ethylpurine-2,6-diamine |
|---|---|
| PubChem CID | 21059575 |
| Molecular Formula | C19H26N7O2PS |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 2-N-(4-aminocyclohexyl)-6-N-(4-dihydroxyphosphinothioylphenyl)-9-ethylpurine-2,6-diamine |
| SMILES | CCn1cnc2c(Nc3ccc(P(O)(O)=S)cc3)nc(NC3CCC(N)CC3)nc21 |
| InChI | InChI=1S/C19H26N7O2PS/c1-2-26-11-21-16-17(22-13-7-9-15(10-8-13)29(27,28)30)24-19(25-18(16)26)23-14-5-3-12(20)4-6-14/h7-12,14H,2-6,20H2,1H3,(H2,27,28,30)(H2,22,23,24,25) |
| InChIKey | KDQSMWOLRHVZDK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 134.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|