C18H24ClN9 — CID 68645723
7-N-(4-amino-3-chlorophenyl)-5-N-(4-aminocyclohexyl)-3-ethyltriazolo[4,5-d]pyrimidine-5,7-diamine (PubChem CID 68645723) has the molecular formula C18H24ClN9 and a molecular weight of 401.91 g/mol. Its IUPAC name is 7-N-(4-amino-3-chlorophenyl)-5-N-(4-aminocyclohexyl)-3-ethyltriazolo[4,5-d]pyrimidine-5,7-diamine.
| Compound Name | 7-N-(4-amino-3-chlorophenyl)-5-N-(4-aminocyclohexyl)-3-ethyltriazolo[4,5-d]pyrimidine-5,7-diamine |
|---|---|
| PubChem CID | 68645723 |
| Molecular Formula | C18H24ClN9 |
| Molecular Weight | 401.91 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 7-N-(4-amino-3-chlorophenyl)-5-N-(4-aminocyclohexyl)-3-ethyltriazolo[4,5-d]pyrimidine-5,7-diamine |
| SMILES | CCn1nnc2c(Nc3ccc(N)c(Cl)c3)nc(NC3CCC(N)CC3)nc21 |
| InChI | InChI=1S/C18H24ClN9/c1-2-28-17-15(26-27-28)16(22-12-7-8-14(21)13(19)9-12)24-18(25-17)23-11-5-3-10(20)4-6-11/h7-11H,2-6,20-21H2,1H3,(H2,22,23,24,25) |
| InChIKey | MZMWIMZPEWPBJB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 132.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.91 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|