C29H39N9O — CID 118073604
1-[2-[9-tert-butyl-6-[4-(4-methylpiperazin-1-yl)anilino]purin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]prop-2-en-1-one (PubChem CID 118073604) has the molecular formula C29H39N9O and a molecular weight of 529.69 g/mol. Its IUPAC name is 1-[2-[9-tert-butyl-6-[4-(4-methylpiperazin-1-yl)anilino]purin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]prop-2-en-1-one.
| Compound Name | 1-[2-[9-tert-butyl-6-[4-(4-methylpiperazin-1-yl)anilino]purin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118073604 |
| Molecular Formula | C29H39N9O |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.33 |
| IUPAC Name | 1-[2-[9-tert-butyl-6-[4-(4-methylpiperazin-1-yl)anilino]purin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC2CN(c3nc(Nc4ccc(N5CCN(C)CC5)cc4)c4ncn(C(C)(C)C)c4n3)CC2C1 |
| InChI | InChI=1S/C29H39N9O/c1-6-24(39)36-15-20-17-37(18-21(20)16-36)28-32-26(25-27(33-28)38(19-30-25)29(2,3)4)31-22-7-9-23(10-8-22)35-13-11-34(5)12-14-35/h6-10,19-21H,1,11-18H2,2-5H3,(H,31,32,33) |
| InChIKey | DCKSANJMXVATHH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|