C28H32ClN7O2 — CID 72703146
1-[3-[3-[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]oxyanilino]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 72703146) has the molecular formula C28H32ClN7O2 and a molecular weight of 534.06 g/mol. Its IUPAC name is 1-[3-[3-[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]oxyanilino]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[3-[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]oxyanilino]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 72703146 |
| Molecular Formula | C28H32ClN7O2 |
| Molecular Weight | 534.06 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | 1-[3-[3-[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]oxyanilino]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Nc2cccc(Oc3nc(Nc4ccc(N5CCN(C)CC5)cc4)ncc3Cl)c2)C1 |
| InChI | InChI=1S/C28H32ClN7O2/c1-3-26(37)36-12-11-22(19-36)31-21-5-4-6-24(17-21)38-27-25(29)18-30-28(33-27)32-20-7-9-23(10-8-20)35-15-13-34(2)14-16-35/h3-10,17-18,22,31H,1,11-16,19H2,2H3,(H,30,32,33) |
| InChIKey | OVQRNTXNPOBZCU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.06 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|