C29H34ClN7O2 — CID 72703144
1-[4-[3-[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]oxyanilino]piperidin-1-yl]prop-2-en-1-one (PubChem CID 72703144) has the molecular formula C29H34ClN7O2 and a molecular weight of 548.09 g/mol. Its IUPAC name is 1-[4-[3-[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]oxyanilino]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[3-[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]oxyanilino]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 72703144 |
| Molecular Formula | C29H34ClN7O2 |
| Molecular Weight | 548.09 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | 1-[4-[3-[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]oxyanilino]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Nc2cccc(Oc3nc(Nc4ccc(N5CCN(C)CC5)cc4)ncc3Cl)c2)CC1 |
| InChI | InChI=1S/C29H34ClN7O2/c1-3-27(38)37-13-11-22(12-14-37)32-23-5-4-6-25(19-23)39-28-26(30)20-31-29(34-28)33-21-7-9-24(10-8-21)36-17-15-35(2)16-18-36/h3-10,19-20,22,32H,1,11-18H2,2H3,(H,31,33,34) |
| InChIKey | XXMSYZCUXKXVGX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.09 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|