C29H33ClN6O5 — CID 86292116
5-[4-[4-[[5-chloro-4-[3-(prop-2-enoylamino)phenoxy]pyrimidin-2-yl]amino]phenoxy]piperidin-1-yl]-N-hydroxypentanamide (PubChem CID 86292116) has the molecular formula C29H33ClN6O5 and a molecular weight of 581.07 g/mol. Its IUPAC name is 5-[4-[4-[[5-chloro-4-[3-(prop-2-enoylamino)phenoxy]pyrimidin-2-yl]amino]phenoxy]piperidin-1-yl]-N-hydroxypentanamide.
| Compound Name | 5-[4-[4-[[5-chloro-4-[3-(prop-2-enoylamino)phenoxy]pyrimidin-2-yl]amino]phenoxy]piperidin-1-yl]-N-hydroxypentanamide |
|---|---|
| PubChem CID | 86292116 |
| Molecular Formula | C29H33ClN6O5 |
| Molecular Weight | 581.07 g/mol |
| Exact Mass | 580.22 |
| IUPAC Name | 5-[4-[4-[[5-chloro-4-[3-(prop-2-enoylamino)phenoxy]pyrimidin-2-yl]amino]phenoxy]piperidin-1-yl]-N-hydroxypentanamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(OC4CCN(CCCCC(=O)NO)CC4)cc3)ncc2Cl)c1 |
| InChI | InChI=1S/C29H33ClN6O5/c1-2-26(37)32-21-6-5-7-24(18-21)41-28-25(30)19-31-29(34-28)33-20-9-11-22(12-10-20)40-23-13-16-36(17-14-23)15-4-3-8-27(38)35-39/h2,5-7,9-12,18-19,23,39H,1,3-4,8,13-17H2,(H,32,37)(H,35,38)(H,31,33,34) |
| InChIKey | NQIZDKXAYCKPQN-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 137.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.07 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|