C30H28ClN5O5 — CID 86292311
4-[4-[4-[[5-chloro-4-[3-(prop-2-enoylamino)phenoxy]pyrimidin-2-yl]amino]phenoxy]butyl]-N-hydroxybenzamide (PubChem CID 86292311) has the molecular formula C30H28ClN5O5 and a molecular weight of 574.04 g/mol. Its IUPAC name is 4-[4-[4-[[5-chloro-4-[3-(prop-2-enoylamino)phenoxy]pyrimidin-2-yl]amino]phenoxy]butyl]-N-hydroxybenzamide.
| Compound Name | 4-[4-[4-[[5-chloro-4-[3-(prop-2-enoylamino)phenoxy]pyrimidin-2-yl]amino]phenoxy]butyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 86292311 |
| Molecular Formula | C30H28ClN5O5 |
| Molecular Weight | 574.04 g/mol |
| Exact Mass | 573.18 |
| IUPAC Name | 4-[4-[4-[[5-chloro-4-[3-(prop-2-enoylamino)phenoxy]pyrimidin-2-yl]amino]phenoxy]butyl]-N-hydroxybenzamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(OCCCCc4ccc(C(=O)NO)cc4)cc3)ncc2Cl)c1 |
| InChI | InChI=1S/C30H28ClN5O5/c1-2-27(37)33-23-7-5-8-25(18-23)41-29-26(31)19-32-30(35-29)34-22-13-15-24(16-14-22)40-17-4-3-6-20-9-11-21(12-10-20)28(38)36-39/h2,5,7-16,18-19,39H,1,3-4,6,17H2,(H,33,37)(H,36,38)(H,32,34,35) |
| InChIKey | VWMPTJJCCRVQDK-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 134.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.04 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|