C21H23ClN6O — CID 141326176
4-(3-aminophenoxy)-5-chloro-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine (PubChem CID 141326176) has the molecular formula C21H23ClN6O and a molecular weight of 410.91 g/mol. Its IUPAC name is 4-(3-aminophenoxy)-5-chloro-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-(3-aminophenoxy)-5-chloro-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 141326176 |
| Molecular Formula | C21H23ClN6O |
| Molecular Weight | 410.91 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 4-(3-aminophenoxy)-5-chloro-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3ncc(Cl)c(Oc4cccc(N)c4)n3)cc2)CC1 |
| InChI | InChI=1S/C21H23ClN6O/c1-27-9-11-28(12-10-27)17-7-5-16(6-8-17)25-21-24-14-19(22)20(26-21)29-18-4-2-3-15(23)13-18/h2-8,13-14H,9-12,23H2,1H3,(H,24,25,26) |
| InChIKey | OQNDXSAIFGXTHK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.91 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|