C20H20ClN5O3S — CID 59362995
4-(2-aminophenoxy)-5-chloro-N-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]pyrimidin-2-amine (PubChem CID 59362995) has the molecular formula C20H20ClN5O3S and a molecular weight of 445.93 g/mol. Its IUPAC name is 4-(2-aminophenoxy)-5-chloro-N-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-(2-aminophenoxy)-5-chloro-N-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 59362995 |
| Molecular Formula | C20H20ClN5O3S |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | 4-(2-aminophenoxy)-5-chloro-N-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]pyrimidin-2-amine |
| SMILES | Nc1ccccc1Oc1nc(Nc2ccc(N3CCS(=O)(=O)CC3)cc2)ncc1Cl |
| InChI | InChI=1S/C20H20ClN5O3S/c21-16-13-23-20(25-19(16)29-18-4-2-1-3-17(18)22)24-14-5-7-15(8-6-14)26-9-11-30(27,28)12-10-26/h1-8,13H,9-12,22H2,(H,23,24,25) |
| InChIKey | IFRJROLSUUMLND-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|