C26H26ClN7O4 — CID 89060359
ethyl 1-[4-[[6-(2-amino-6-chlorophenyl)-5,7-dioxo-8H-pyrimido[4,5-d]pyrimidin-2-yl]amino]phenyl]piperidine-4-carboxylate (PubChem CID 89060359) has the molecular formula C26H26ClN7O4 and a molecular weight of 535.99 g/mol. Its IUPAC name is ethyl 1-[4-[[6-(2-amino-6-chlorophenyl)-5,7-dioxo-8H-pyrimido[4,5-d]pyrimidin-2-yl]amino]phenyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-[[6-(2-amino-6-chlorophenyl)-5,7-dioxo-8H-pyrimido[4,5-d]pyrimidin-2-yl]amino]phenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 89060359 |
| Molecular Formula | C26H26ClN7O4 |
| Molecular Weight | 535.99 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | ethyl 1-[4-[[6-(2-amino-6-chlorophenyl)-5,7-dioxo-8H-pyrimido[4,5-d]pyrimidin-2-yl]amino]phenyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc(Nc3ncc4c(=O)n(-c5c(N)cccc5Cl)c(=O)[nH]c4n3)cc2)CC1 |
| InChI | InChI=1S/C26H26ClN7O4/c1-2-38-24(36)15-10-12-33(13-11-15)17-8-6-16(7-9-17)30-25-29-14-18-22(31-25)32-26(37)34(23(18)35)21-19(27)4-3-5-20(21)28/h3-9,14-15H,2,10-13,28H2,1H3,(H2,29,30,31,32,37) |
| InChIKey | PXPZVTYPNMNROD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.99 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|