C23H29ClN6O4 — CID 21080899
ethyl 1-[1-[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]piperidin-4-yl]piperidine-4-carboxylate (PubChem CID 21080899) has the molecular formula C23H29ClN6O4 and a molecular weight of 488.98 g/mol. Its IUPAC name is ethyl 1-[1-[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]piperidin-4-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[1-[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]piperidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 21080899 |
| Molecular Formula | C23H29ClN6O4 |
| Molecular Weight | 488.98 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | ethyl 1-[1-[2-(4-chloroanilino)-5-nitropyrimidin-4-yl]piperidin-4-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C2CCN(c3nc(Nc4ccc(Cl)cc4)ncc3[N+](=O)[O-])CC2)CC1 |
| InChI | InChI=1S/C23H29ClN6O4/c1-2-34-22(31)16-7-11-28(12-8-16)19-9-13-29(14-10-19)21-20(30(32)33)15-25-23(27-21)26-18-5-3-17(24)4-6-18/h3-6,15-16,19H,2,7-14H2,1H3,(H,25,26,27) |
| InChIKey | PZEMIZXYGKLCFQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.98 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|