C23H30ClN5O3 — CID 121410373
ethyl 1-[4-[[5-chloro-4-[methyl-[(2S)-oxolan-2-yl]amino]pyrimidin-2-yl]amino]phenyl]piperidine-4-carboxylate (PubChem CID 121410373) has the molecular formula C23H30ClN5O3 and a molecular weight of 459.98 g/mol. Its IUPAC name is ethyl 1-[4-[[5-chloro-4-[methyl-[(2S)-oxolan-2-yl]amino]pyrimidin-2-yl]amino]phenyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-[[5-chloro-4-[methyl-[(2S)-oxolan-2-yl]amino]pyrimidin-2-yl]amino]phenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 121410373 |
| Molecular Formula | C23H30ClN5O3 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | ethyl 1-[4-[[5-chloro-4-[methyl-[(2S)-oxolan-2-yl]amino]pyrimidin-2-yl]amino]phenyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc(Nc3ncc(Cl)c(N(C)[C@@H]4CCCO4)n3)cc2)CC1 |
| InChI | InChI=1S/C23H30ClN5O3/c1-3-31-22(30)16-10-12-29(13-11-16)18-8-6-17(7-9-18)26-23-25-15-19(24)21(27-23)28(2)20-5-4-14-32-20/h6-9,15-16,20H,3-5,10-14H2,1-2H3,(H,25,26,27)/t20-/m0/s1 |
| InChIKey | DEEOCWGCHYHGFA-FQEVSTJZSA-N |
| XLogP | 4.23 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|