C20H26BN5O — CID 89175679
CID 89175679 (PubChem CID 89175679) has the molecular formula C20H26BN5O and a molecular weight of 363.27 g/mol.
| Compound Name | CID 89175679 |
|---|---|
| PubChem CID | 89175679 |
| Molecular Formula | C20H26BN5O |
| Molecular Weight | 363.27 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(Nc2ccc(N3CCOCC3)cc2)nc1N(C)C1CCCC1 |
| InChI | InChI=1S/C20H26BN5O/c1-25(16-4-2-3-5-16)19-18(21)14-22-20(24-19)23-15-6-8-17(9-7-15)26-10-12-27-13-11-26/h6-9,14,16H,2-5,10-13H2,1H3,(H,22,23,24) |
| InChIKey | NWZNEOXBOBPEFO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|