C22H28N6O3 — CID 89374545
N-[4-[cyclopentyl(formyl)amino]-2-(4-morpholin-4-ylanilino)pyrimidin-5-yl]acetamide (PubChem CID 89374545) has the molecular formula C22H28N6O3 and a molecular weight of 424.51 g/mol. Its IUPAC name is N-[4-[cyclopentyl(formyl)amino]-2-(4-morpholin-4-ylanilino)pyrimidin-5-yl]acetamide.
| Compound Name | N-[4-[cyclopentyl(formyl)amino]-2-(4-morpholin-4-ylanilino)pyrimidin-5-yl]acetamide |
|---|---|
| PubChem CID | 89374545 |
| Molecular Formula | C22H28N6O3 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | N-[4-[cyclopentyl(formyl)amino]-2-(4-morpholin-4-ylanilino)pyrimidin-5-yl]acetamide |
| SMILES | CC(=O)Nc1cnc(Nc2ccc(N3CCOCC3)cc2)nc1N(C=O)C1CCCC1 |
| InChI | InChI=1S/C22H28N6O3/c1-16(30)24-20-14-23-22(26-21(20)28(15-29)19-4-2-3-5-19)25-17-6-8-18(9-7-17)27-10-12-31-13-11-27/h6-9,14-15,19H,2-5,10-13H2,1H3,(H,24,30)(H,23,25,26) |
| InChIKey | ZSWZIEKPGGTHMP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|