C22H24N6O2S — CID 59491723
N-[4-[5-amino-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]acetamide (PubChem CID 59491723) has the molecular formula C22H24N6O2S and a molecular weight of 436.54 g/mol. Its IUPAC name is N-[4-[5-amino-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]acetamide.
| Compound Name | N-[4-[5-amino-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 59491723 |
| Molecular Formula | C22H24N6O2S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | N-[4-[5-amino-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]sulfanylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Sc2nc(Nc3ccc(N4CCOCC4)cc3)ncc2N)cc1 |
| InChI | InChI=1S/C22H24N6O2S/c1-15(29)25-16-4-8-19(9-5-16)31-21-20(23)14-24-22(27-21)26-17-2-6-18(7-3-17)28-10-12-30-13-11-28/h2-9,14H,10-13,23H2,1H3,(H,25,29)(H,24,26,27) |
| InChIKey | SULCJVDUCNWSLZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|