C28H33N7O3 — CID 167577161
2-(4-acetylphenyl)-1-[4-[5-amino-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]piperazin-1-yl]ethanone (PubChem CID 167577161) has the molecular formula C28H33N7O3 and a molecular weight of 515.62 g/mol. Its IUPAC name is 2-(4-acetylphenyl)-1-[4-[5-amino-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]piperazin-1-yl]ethanone.
| Compound Name | 2-(4-acetylphenyl)-1-[4-[5-amino-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 167577161 |
| Molecular Formula | C28H33N7O3 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | 2-(4-acetylphenyl)-1-[4-[5-amino-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)c1ccc(CC(=O)N2CCN(c3nc(Nc4ccc(N5CCOCC5)cc4)ncc3N)CC2)cc1 |
| InChI | InChI=1S/C28H33N7O3/c1-20(36)22-4-2-21(3-5-22)18-26(37)34-10-12-35(13-11-34)27-25(29)19-30-28(32-27)31-23-6-8-24(9-7-23)33-14-16-38-17-15-33/h2-9,19H,10-18,29H2,1H3,(H,30,31,32) |
| InChIKey | GRTLJCIIUAAKJN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|