C20H24F3N7O2 — CID 175343864
4-[2-(4-morpholin-4-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]piperazine-1-carboxamide (PubChem CID 175343864) has the molecular formula C20H24F3N7O2 and a molecular weight of 451.45 g/mol. Its IUPAC name is 4-[2-(4-morpholin-4-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]piperazine-1-carboxamide.
| Compound Name | 4-[2-(4-morpholin-4-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 175343864 |
| Molecular Formula | C20H24F3N7O2 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 4-[2-(4-morpholin-4-ylanilino)-5-(trifluoromethyl)pyrimidin-4-yl]piperazine-1-carboxamide |
| SMILES | NC(=O)N1CCN(c2nc(Nc3ccc(N4CCOCC4)cc3)ncc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H24F3N7O2/c21-20(22,23)16-13-25-19(27-17(16)29-5-7-30(8-6-29)18(24)31)26-14-1-3-15(4-2-14)28-9-11-32-12-10-28/h1-4,13H,5-12H2,(H2,24,31)(H,25,26,27) |
| InChIKey | JSMWQAQYBLIQEX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|