C14H15N3O3S — CID 80571818
2-(4-morpholin-4-ylanilino)-1,3-thiazole-5-carboxylic acid (PubChem CID 80571818) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-(4-morpholin-4-ylanilino)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(4-morpholin-4-ylanilino)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 80571818 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 2-(4-morpholin-4-ylanilino)-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(Nc2ccc(N3CCOCC3)cc2)s1 |
| InChI | InChI=1S/C14H15N3O3S/c18-13(19)12-9-15-14(21-12)16-10-1-3-11(4-2-10)17-5-7-20-8-6-17/h1-4,9H,5-8H2,(H,15,16)(H,18,19) |
| InChIKey | JKVOCJFFGBBDSA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|