2-(4-morpholin-4-ylanilino)-1,3-thiazole-5-carboxylic acid

C14H15N3O3S — CID 80571818

IUPAC2-(4-morpholin-4-ylanilino)-1,3-thiazole-5-carboxylic acid
SMILESO=C(O)c1cnc(Nc2ccc(N3CCOCC3)cc2)s1
InChIInChI=1S/C14H15N3O3S/c18-13(19)12-9-15-14(21-12)16-10-1-3-11(4-2-10)17-5-7-20-8-6-17/h1-4,9H,5-8H2,(H,15,16)(H,18,19)
InChIKeyJKVOCJFFGBBDSA-UHFFFAOYSA-N
MW305.36 g/mol
LogP2.42
Rot. Bonds4

About 2-(4-morpholin-4-ylanilino)-1,3-thiazole-5-carboxylic acid

2-(4-morpholin-4-ylanilino)-1,3-thiazole-5-carboxylic acid (PubChem CID 80571818) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-(4-morpholin-4-ylanilino)-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(4-morpholin-4-ylanilino)-1,3-thiazole-5-carboxylic acid
PubChem CID80571818
Molecular FormulaC14H15N3O3S
Molecular Weight305.36 g/mol
Exact Mass305.08
IUPAC Name2-(4-morpholin-4-ylanilino)-1,3-thiazole-5-carboxylic acid
SMILESO=C(O)c1cnc(Nc2ccc(N3CCOCC3)cc2)s1
InChIInChI=1S/C14H15N3O3S/c18-13(19)12-9-15-14(21-12)16-10-1-3-11(4-2-10)17-5-7-20-8-6-17/h1-4,9H,5-8H2,(H,15,16)(H,18,19)
InChIKeyJKVOCJFFGBBDSA-UHFFFAOYSA-N
XLogP2.42
TPSA74.69 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.36
LogP ≤ 52.42
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}

Analyze 2-(4-morpholin-4-ylanilino)-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-morpholin-4-ylanilino)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(4-morpholin-4-ylanilino)-1,3-thiazole-5-carboxylic acid (CID 80571818) is 2-(4-morpholin-4-ylanilino)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(4-morpholin-4-ylanilino)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(4-morpholin-4-ylanilino)-1,3-thiazole-5-carboxylic acid is O=C(O)c1cnc(Nc2ccc(N3CCOCC3)cc2)s1.
What is the InChIKey of 2-(4-morpholin-4-ylanilino)-1,3-thiazole-5-carboxylic acid?
The InChIKey is JKVOCJFFGBBDSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O3S/c18-13(19)12-9-15-14(21-12)16-10-1-3-11(4-2-10)17-5-7-20-8-6-17/h1-4,9H,5-8H2,(H,15,16)(H,18,19).
What are the key properties of 2-(4-morpholin-4-ylanilino)-1,3-thiazole-5-carboxylic acid?
2-(4-morpholin-4-ylanilino)-1,3-thiazole-5-carboxylic acid has a molecular weight of 305.36 g/mol, XLogP of 2.42, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-morpholin-4-ylanilino)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 80571818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).