C12H13BrN4OS — CID 64624123
5-bromo-N-(4-morpholin-4-ylphenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 64624123) has the molecular formula C12H13BrN4OS and a molecular weight of 341.23 g/mol. Its IUPAC name is 5-bromo-N-(4-morpholin-4-ylphenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-bromo-N-(4-morpholin-4-ylphenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 64624123 |
| Molecular Formula | C12H13BrN4OS |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 5-bromo-N-(4-morpholin-4-ylphenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | Brc1nnc(Nc2ccc(N3CCOCC3)cc2)s1 |
| InChI | InChI=1S/C12H13BrN4OS/c13-11-15-16-12(19-11)14-9-1-3-10(4-2-9)17-5-7-18-8-6-17/h1-4H,5-8H2,(H,14,16) |
| InChIKey | NQYOLOYXILFJGO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|