C13H17N3OS — CID 2731411
N-(4-morpholin-4-ylphenyl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 2731411) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | N-(4-morpholin-4-ylphenyl)-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 2731411 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | c1cc(N2CCOCC2)ccc1NC1=NCCS1 |
| InChI | InChI=1S/C13H17N3OS/c1-3-12(16-6-8-17-9-7-16)4-2-11(1)15-13-14-5-10-18-13/h1-4H,5-10H2,(H,14,15) |
| InChIKey | WJFNYGITGPAHLZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|