C10H10N2O2S — CID 29068023
N-(1,3-benzodioxol-5-yl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 29068023) has the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | N-(1,3-benzodioxol-5-yl)-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 29068023 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | c1cc2c(cc1NC1=NCCS1)OCO2 |
| InChI | InChI=1S/C10H10N2O2S/c1-2-8-9(14-6-13-8)5-7(1)12-10-11-3-4-15-10/h1-2,5H,3-4,6H2,(H,11,12) |
| InChIKey | WRDSHUAQNMSJGB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |