C9H8F2N2S — CID 29068216
N-(3,4-difluorophenyl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 29068216) has the molecular formula C9H8F2N2S and a molecular weight of 214.24 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | N-(3,4-difluorophenyl)-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 29068216 |
| Molecular Formula | C9H8F2N2S |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | N-(3,4-difluorophenyl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | Fc1ccc(NC2=NCCS2)cc1F |
| InChI | InChI=1S/C9H8F2N2S/c10-7-2-1-6(5-8(7)11)13-9-12-3-4-14-9/h1-2,5H,3-4H2,(H,12,13) |
| InChIKey | SQMDGCUMWVFWNF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |