C10H12N2S — CID 7303198
N-(4-methylphenyl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 7303198) has the molecular formula C10H12N2S and a molecular weight of 192.29 g/mol. Its IUPAC name is N-(4-methylphenyl)-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | N-(4-methylphenyl)-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 7303198 |
| Molecular Formula | C10H12N2S |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | N-(4-methylphenyl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | Cc1ccc(NC2=NCCS2)cc1 |
| InChI | InChI=1S/C10H12N2S/c1-8-2-4-9(5-3-8)12-10-11-6-7-13-10/h2-5H,6-7H2,1H3,(H,11,12) |
| InChIKey | ZIBKTRFJHTUEKA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |