4-(4,5-dihydro-1,3-thiazol-2-ylamino)-2-hydroxybenzoic acid

C10H10N2O3S — CID 126478304

IUPAC4-(4,5-dihydro-1,3-thiazol-2-ylamino)-2-hydroxybenzoic acid
SMILESO=C(O)c1ccc(NC2=NCCS2)cc1O
InChIInChI=1S/C10H10N2O3S/c13-8-5-6(1-2-7(8)9(14)15)12-10-11-3-4-16-10/h1-2,5,13H,3-4H2,(H,11,12)(H,14,15)
InChIKeyUXJIWPWWPARVGT-UHFFFAOYSA-N
MW238.27 g/mol
LogP1.61
Rot. Bonds2

About 4-(4,5-dihydro-1,3-thiazol-2-ylamino)-2-hydroxybenzoic acid

4-(4,5-dihydro-1,3-thiazol-2-ylamino)-2-hydroxybenzoic acid (PubChem CID 126478304) has the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. Its IUPAC name is 4-(4,5-dihydro-1,3-thiazol-2-ylamino)-2-hydroxybenzoic acid.

Molecular Properties

Compound Name4-(4,5-dihydro-1,3-thiazol-2-ylamino)-2-hydroxybenzoic acid
PubChem CID126478304
Molecular FormulaC10H10N2O3S
Molecular Weight238.27 g/mol
Exact Mass238.04
IUPAC Name4-(4,5-dihydro-1,3-thiazol-2-ylamino)-2-hydroxybenzoic acid
SMILESO=C(O)c1ccc(NC2=NCCS2)cc1O
InChIInChI=1S/C10H10N2O3S/c13-8-5-6(1-2-7(8)9(14)15)12-10-11-3-4-16-10/h1-2,5,13H,3-4H2,(H,11,12)(H,14,15)
InChIKeyUXJIWPWWPARVGT-UHFFFAOYSA-N
XLogP1.61
TPSA81.92 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.27
LogP ≤ 51.61
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 4-(4,5-dihydro-1,3-thiazol-2-ylamino)-2-hydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4,5-dihydro-1,3-thiazol-2-ylamino)-2-hydroxybenzoic acid?
The IUPAC name of 4-(4,5-dihydro-1,3-thiazol-2-ylamino)-2-hydroxybenzoic acid (CID 126478304) is 4-(4,5-dihydro-1,3-thiazol-2-ylamino)-2-hydroxybenzoic acid.
What is the SMILES notation for 4-(4,5-dihydro-1,3-thiazol-2-ylamino)-2-hydroxybenzoic acid?
The canonical SMILES for 4-(4,5-dihydro-1,3-thiazol-2-ylamino)-2-hydroxybenzoic acid is O=C(O)c1ccc(NC2=NCCS2)cc1O.
What is the InChIKey of 4-(4,5-dihydro-1,3-thiazol-2-ylamino)-2-hydroxybenzoic acid?
The InChIKey is UXJIWPWWPARVGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O3S/c13-8-5-6(1-2-7(8)9(14)15)12-10-11-3-4-16-10/h1-2,5,13H,3-4H2,(H,11,12)(H,14,15).
What are the key properties of 4-(4,5-dihydro-1,3-thiazol-2-ylamino)-2-hydroxybenzoic acid?
4-(4,5-dihydro-1,3-thiazol-2-ylamino)-2-hydroxybenzoic acid has a molecular weight of 238.27 g/mol, XLogP of 1.61, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dihydro-1,3-thiazol-2-ylamino)-2-hydroxybenzoic acid is sourced from PubChem (CID 126478304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).