C11H10N2O3S — CID 2859080
2-(4,5-dihydro-1,3-thiazol-2-ylcarbamoyl)benzoic acid (PubChem CID 2859080) has the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. Its IUPAC name is 2-(4,5-dihydro-1,3-thiazol-2-ylcarbamoyl)benzoic acid.
| Compound Name | 2-(4,5-dihydro-1,3-thiazol-2-ylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 2859080 |
| Molecular Formula | C11H10N2O3S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 2-(4,5-dihydro-1,3-thiazol-2-ylcarbamoyl)benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)NC1=NCCS1 |
| InChI | InChI=1S/C11H10N2O3S/c14-9(13-11-12-5-6-17-11)7-3-1-2-4-8(7)10(15)16/h1-4H,5-6H2,(H,15,16)(H,12,13,14) |
| InChIKey | CGPSZIWTWQTWGN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |