C12H14N2O3S — CID 78791862
N-(4,5-dihydro-1,3-thiazol-2-yl)-2,5-dimethoxybenzamide (PubChem CID 78791862) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-2,5-dimethoxybenzamide.
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 78791862 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-2,5-dimethoxybenzamide |
| SMILES | COc1ccc(OC)c(C(=O)NC2=NCCS2)c1 |
| InChI | InChI=1S/C12H14N2O3S/c1-16-8-3-4-10(17-2)9(7-8)11(15)14-12-13-5-6-18-12/h3-4,7H,5-6H2,1-2H3,(H,13,14,15) |
| InChIKey | NCKFQODJCRBLCR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |