C12H15N3O3S — CID 5146476
1-(4,5-dihydro-1,3-thiazol-2-yl)-3-(2,4-dimethoxyphenyl)urea (PubChem CID 5146476) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is 1-(4,5-dihydro-1,3-thiazol-2-yl)-3-(2,4-dimethoxyphenyl)urea.
| Compound Name | 1-(4,5-dihydro-1,3-thiazol-2-yl)-3-(2,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 5146476 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 1-(4,5-dihydro-1,3-thiazol-2-yl)-3-(2,4-dimethoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)NC2=NCCS2)c(OC)c1 |
| InChI | InChI=1S/C12H15N3O3S/c1-17-8-3-4-9(10(7-8)18-2)14-11(16)15-12-13-5-6-19-12/h3-4,7H,5-6H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | LFLLYDMEYYTXNH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |